diff options
Diffstat (limited to 'src/graphics/d3d/d3dutil.cpp')
-rw-r--r-- | src/graphics/d3d/d3dutil.cpp | 327 |
1 files changed, 327 insertions, 0 deletions
diff --git a/src/graphics/d3d/d3dutil.cpp b/src/graphics/d3d/d3dutil.cpp new file mode 100644 index 0000000..b4a0eb7 --- /dev/null +++ b/src/graphics/d3d/d3dutil.cpp @@ -0,0 +1,327 @@ +// * This file is part of the COLOBOT source code
+// * Copyright (C) 2001-2008, Daniel ROUX & EPSITEC SA, www.epsitec.ch
+// *
+// * This program is free software: you can redistribute it and/or modify
+// * it under the terms of the GNU General Public License as published by
+// * the Free Software Foundation, either version 3 of the License, or
+// * (at your option) any later version.
+// *
+// * This program is distributed in the hope that it will be useful,
+// * but WITHOUT ANY WARRANTY; without even the implied warranty of
+// * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+// * GNU General Public License for more details.
+// *
+// * You should have received a copy of the GNU General Public License
+// * along with this program. If not, see http://www.gnu.org/licenses/.
+
+//-----------------------------------------------------------------------------
+// File: D3DUtil.cpp
+//
+// Desc: Shortcut macros and functions for using DX objects
+//
+//
+// Copyright (c) 1997-1999 Microsoft Corporation. All rights reserved
+//-----------------------------------------------------------------------------
+#define D3D_OVERLOADS
+#define STRICT
+#include <math.h>
+#include <stdio.h>
+#include <tchar.h>
+#include "d3dutil.h"
+
+
+
+
+//-----------------------------------------------------------------------------
+// Name: D3DUtil_GetDXSDKMediaPath()
+// Desc: Returns the DirectX SDK media path, as stored in the system registry
+// during the SDK install.
+//-----------------------------------------------------------------------------
+const TCHAR* D3DUtil_GetDXSDKMediaPath()
+{
+ static TCHAR strNull[2] = _T("");
+ static TCHAR strPath[512];
+ HKEY key;
+ DWORD type, size = 512;
+
+ // Open the appropriate registry key
+ LONG result = RegOpenKeyEx( HKEY_LOCAL_MACHINE,
+ _T("Software\\Microsoft\\DirectX"),
+ 0, KEY_READ, &key );
+ if( ERROR_SUCCESS != result )
+ return strNull;
+
+ result = RegQueryValueEx( key, _T("DXSDK Samples Path"), NULL,
+ &type, (BYTE*)strPath, &size );
+ RegCloseKey( key );
+
+ if( ERROR_SUCCESS != result )
+ return strNull;
+
+ lstrcat( strPath, _T("\\D3DIM\\Media\\") );
+
+ return strPath;
+}
+
+
+
+
+//-----------------------------------------------------------------------------
+// Name: D3DUtil_InitSurfaceDesc()
+// Desc: Helper function called to build a DDSURFACEDESC2 structure,
+// typically before calling CreateSurface() or GetSurfaceDesc()
+//-----------------------------------------------------------------------------
+VOID D3DUtil_InitSurfaceDesc( DDSURFACEDESC2& ddsd, DWORD dwFlags,
+ DWORD dwCaps )
+{
+ ZeroMemory( &ddsd, sizeof(ddsd) );
+ ddsd.dwSize = sizeof(ddsd);
+ ddsd.dwFlags = dwFlags;
+ ddsd.ddsCaps.dwCaps = dwCaps;
+ ddsd.ddpfPixelFormat.dwSize = sizeof(DDPIXELFORMAT);
+}
+
+
+
+
+//-----------------------------------------------------------------------------
+// Name: D3DUtil_InitMaterial()
+// Desc: Helper function called to build a D3DMATERIAL7 structure
+//-----------------------------------------------------------------------------
+VOID D3DUtil_InitMaterial( D3DMATERIAL7& mtrl, FLOAT r, FLOAT g, FLOAT b,
+ FLOAT a )
+{
+ ZeroMemory( &mtrl, sizeof(D3DMATERIAL7) );
+ mtrl.dcvDiffuse.r = mtrl.dcvAmbient.r = r;
+ mtrl.dcvDiffuse.g = mtrl.dcvAmbient.g = g;
+ mtrl.dcvDiffuse.b = mtrl.dcvAmbient.b = b;
+ mtrl.dcvDiffuse.a = mtrl.dcvAmbient.a = a;
+}
+
+
+
+
+//-----------------------------------------------------------------------------
+// Name: D3DUtil_InitLight()
+// Desc: Initializes a D3DLIGHT7 structure
+//-----------------------------------------------------------------------------
+VOID D3DUtil_InitLight( D3DLIGHT7& light, D3DLIGHTTYPE ltType,
+ FLOAT x, FLOAT y, FLOAT z )
+{
+ ZeroMemory( &light, sizeof(D3DLIGHT7) );
+ light.dltType = ltType;
+ light.dcvDiffuse.r = 1.0f;
+ light.dcvDiffuse.g = 1.0f;
+ light.dcvDiffuse.b = 1.0f;
+ light.dcvSpecular = light.dcvDiffuse;
+ light.dvPosition.x = light.dvDirection.x = x;
+ light.dvPosition.y = light.dvDirection.y = y;
+ light.dvPosition.z = light.dvDirection.z = z;
+ light.dvAttenuation0 = 1.0f;
+ light.dvRange = D3DLIGHT_RANGE_MAX;
+}
+
+
+
+
+//-----------------------------------------------------------------------------
+// Name: D3DUtil_SetViewMatrix()
+// Desc: Given an eye point, a lookat point, and an up vector, this
+// function builds a 4x4 view matrix.
+//-----------------------------------------------------------------------------
+HRESULT D3DUtil_SetViewMatrix( D3DMATRIX& mat, D3DVECTOR& vFrom,
+ D3DVECTOR& vAt, D3DVECTOR& vWorldUp )
+{
+ // Get the z basis vector, which points straight ahead. This is the
+ // difference from the eyepoint to the lookat point.
+ D3DVECTOR vView = vAt - vFrom;
+
+ FLOAT fLength = Magnitude( vView );
+ if( fLength < 1e-6f )
+ return E_INVALIDARG;
+
+ // Normalize the z basis vector
+ vView /= fLength;
+
+ // Get the dot product, and calculate the projection of the z basis
+ // vector onto the up vector. The projection is the y basis vector.
+ FLOAT fDotProduct = DotProduct( vWorldUp, vView );
+
+ D3DVECTOR vUp = vWorldUp - fDotProduct * vView;
+
+ // If this vector has near-zero length because the input specified a
+ // bogus up vector, let's try a default up vector
+ if( 1e-6f > ( fLength = Magnitude( vUp ) ) )
+ {
+ vUp = D3DVECTOR( 0.0f, 1.0f, 0.0f ) - vView.y * vView;
+
+ // If we still have near-zero length, resort to a different axis.
+ if( 1e-6f > ( fLength = Magnitude( vUp ) ) )
+ {
+ vUp = D3DVECTOR( 0.0f, 0.0f, 1.0f ) - vView.z * vView;
+
+ if( 1e-6f > ( fLength = Magnitude( vUp ) ) )
+ return E_INVALIDARG;
+ }
+ }
+
+ // Normalize the y basis vector
+ vUp /= fLength;
+
+ // The x basis vector is found simply with the cross product of the y
+ // and z basis vectors
+ D3DVECTOR vRight = CrossProduct( vUp, vView );
+
+ // Start building the matrix. The first three rows contains the basis
+ // vectors used to rotate the view to point at the lookat point
+ D3DUtil_SetIdentityMatrix( mat );
+ mat._11 = vRight.x; mat._12 = vUp.x; mat._13 = vView.x;
+ mat._21 = vRight.y; mat._22 = vUp.y; mat._23 = vView.y;
+ mat._31 = vRight.z; mat._32 = vUp.z; mat._33 = vView.z;
+
+ // Do the translation values (rotations are still about the eyepoint)
+ mat._41 = - DotProduct( vFrom, vRight );
+ mat._42 = - DotProduct( vFrom, vUp );
+ mat._43 = - DotProduct( vFrom, vView );
+
+ return S_OK;
+}
+
+
+
+
+//-----------------------------------------------------------------------------
+// Name: D3DUtil_SetProjectionMatrix()
+// Desc: Sets the passed in 4x4 matrix to a perpsective projection matrix built
+// from the field-of-view (fov, in y), aspect ratio, near plane (D),
+// and far plane (F). Note that the projection matrix is normalized for
+// element [3][4] to be 1.0. This is performed so that W-based range fog
+// will work correctly.
+//-----------------------------------------------------------------------------
+HRESULT D3DUtil_SetProjectionMatrix( D3DMATRIX& mat, FLOAT fFOV, FLOAT fAspect,
+ FLOAT fNearPlane, FLOAT fFarPlane )
+{
+ if( fabs(fFarPlane-fNearPlane) < 0.01f )
+ return E_INVALIDARG;
+ if( fabs(sin(fFOV/2)) < 0.01f )
+ return E_INVALIDARG;
+
+ FLOAT w = fAspect * ( cosf(fFOV/2)/sinf(fFOV/2) );
+ FLOAT h = 1.0f * ( cosf(fFOV/2)/sinf(fFOV/2) );
+ FLOAT Q = fFarPlane / ( fFarPlane - fNearPlane );
+
+ ZeroMemory( &mat, sizeof(D3DMATRIX) );
+ mat._11 = w;
+ mat._22 = h;
+ mat._33 = Q;
+ mat._34 = 1.0f;
+ mat._43 = -Q*fNearPlane;
+
+ return S_OK;
+}
+
+
+
+
+//-----------------------------------------------------------------------------
+// Name: D3DUtil_SetRotateXMatrix()
+// Desc: Create Rotation matrix about X axis
+//-----------------------------------------------------------------------------
+VOID D3DUtil_SetRotateXMatrix( D3DMATRIX& mat, FLOAT fRads )
+{
+ D3DUtil_SetIdentityMatrix( mat );
+ mat._22 = cosf( fRads );
+ mat._23 = sinf( fRads );
+ mat._32 = -sinf( fRads );
+ mat._33 = cosf( fRads );
+}
+
+
+
+
+//-----------------------------------------------------------------------------
+// Name: D3DUtil_SetRotateYMatrix()
+// Desc: Create Rotation matrix about Y axis
+//-----------------------------------------------------------------------------
+VOID D3DUtil_SetRotateYMatrix( D3DMATRIX& mat, FLOAT fRads )
+{
+ D3DUtil_SetIdentityMatrix( mat );
+ mat._11 = cosf( fRads );
+ mat._13 = -sinf( fRads );
+ mat._31 = sinf( fRads );
+ mat._33 = cosf( fRads );
+}
+
+
+
+
+//-----------------------------------------------------------------------------
+// Name: D3DUtil_SetRotateZMatrix()
+// Desc: Create Rotation matrix about Z axis
+//-----------------------------------------------------------------------------
+VOID D3DUtil_SetRotateZMatrix( D3DMATRIX& mat, FLOAT fRads )
+{
+ D3DUtil_SetIdentityMatrix( mat );
+ mat._11 = cosf( fRads );
+ mat._12 = sinf( fRads );
+ mat._21 = -sinf( fRads );
+ mat._22 = cosf( fRads );
+}
+
+
+
+
+//-----------------------------------------------------------------------------
+// Name: D3DUtil_SetRotationMatrix
+// Desc: Create a Rotation matrix about vector direction
+//-----------------------------------------------------------------------------
+VOID D3DUtil_SetRotationMatrix( D3DMATRIX& mat, D3DVECTOR& vDir, FLOAT fRads )
+{
+ FLOAT fCos = cosf( fRads );
+ FLOAT fSin = sinf( fRads );
+ D3DVECTOR v = Normalize( vDir );
+
+ mat._11 = ( v.x * v.x ) * ( 1.0f - fCos ) + fCos;
+ mat._12 = ( v.x * v.y ) * ( 1.0f - fCos ) - (v.z * fSin);
+ mat._13 = ( v.x * v.z ) * ( 1.0f - fCos ) + (v.y * fSin);
+
+ mat._21 = ( v.y * v.x ) * ( 1.0f - fCos ) + (v.z * fSin);
+ mat._22 = ( v.y * v.y ) * ( 1.0f - fCos ) + fCos ;
+ mat._23 = ( v.y * v.z ) * ( 1.0f - fCos ) - (v.x * fSin);
+
+ mat._31 = ( v.z * v.x ) * ( 1.0f - fCos ) - (v.y * fSin);
+ mat._32 = ( v.z * v.y ) * ( 1.0f - fCos ) + (v.x * fSin);
+ mat._33 = ( v.z * v.z ) * ( 1.0f - fCos ) + fCos;
+
+ mat._14 = mat._24 = mat._34 = 0.0f;
+ mat._41 = mat._42 = mat._43 = 0.0f;
+ mat._44 = 1.0f;
+}
+
+
+
+
+//-----------------------------------------------------------------------------
+// Name: _DbgOut()
+// Desc: Outputs a message to the debug stream
+//-----------------------------------------------------------------------------
+HRESULT _DbgOut( TCHAR* strFile, DWORD dwLine, HRESULT hr, TCHAR* strMsg )
+{
+ TCHAR buffer[256];
+ wsprintf( buffer, _T("%s(%ld): "), strFile, dwLine );
+ OutputDebugString( buffer );
+ OutputDebugString( strMsg );
+
+ if( hr )
+ {
+ wsprintf( buffer, _T("(hr=%08lx)\n"), hr );
+ OutputDebugString( buffer );
+ }
+
+ OutputDebugString( _T("\n") );
+
+ return hr;
+}
+
+
+
|